Product Information:
| Cat. No.: EX-A8599 | Purity: >98% |
![]() | |
| Chemical structure of SAR 444727 |
| Size | Unit Price (US$) | Stock | Quantity | Order |
|---|
| Send PO to E-mail:order@excenen.com; or Fax:+86 020 81619670 |
| Discount Request |
| Synonyms | Atuzabrutinib |
|---|---|
| Synonyms 2 | PRN473 |
| CAS No. | 1581714-49-9 |
| Purity | >98% |
| Formula | C30H30FN7O2 |
| Mol Weight | 539.6033 |
| Reference: | |
| CoA | CoA of SAR 444727 |
| Smiles: | NC1=C2C(N([C@H]3CN(CCC3)C(/C(C#N)=C/C(C)(C)C)=O)N=C2C4=C(C=C(C=C4)OC5=CC=CC=C5)F)=NC=N1 |
|---|
KEYWORDS: buy SAR 444727 | SAR 444727 supplier | purchase | cost | manufacturer | order | distributor | buy 1581714-49-9 | 1581714-49-9 supplier


Inhibitor Specialist
